C14H15N5O2 — CID 137200070
2-(2-methyl-1H-indol-3-yl)-N-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]acetamide (PubChem CID 137200070) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 2-(2-methyl-1H-indol-3-yl)-N-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]acetamide.
| Compound Name | 2-(2-methyl-1H-indol-3-yl)-N-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 137200070 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-(2-methyl-1H-indol-3-yl)-N-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]acetamide |
| SMILES | Cc1[nH]c2ccccc2c1CC(=O)NCc1n[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C14H15N5O2/c1-8-10(9-4-2-3-5-11(9)16-8)6-13(20)15-7-12-17-14(21)19-18-12/h2-5,16H,6-7H2,1H3,(H,15,20)(H2,17,18,19,21) |
| InChIKey | UXMJQVVLBLMPFG-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 106.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|