C16H16N2O2 — CID 31848406
N-(furan-2-ylmethyl)-2-(2-methyl-1H-indol-3-yl)acetamide (PubChem CID 31848406) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(2-methyl-1H-indol-3-yl)acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-(2-methyl-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 31848406 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(2-methyl-1H-indol-3-yl)acetamide |
| SMILES | Cc1[nH]c2ccccc2c1CC(=O)NCc1ccco1 |
| InChI | InChI=1S/C16H16N2O2/c1-11-14(13-6-2-3-7-15(13)18-11)9-16(19)17-10-12-5-4-8-20-12/h2-8,18H,9-10H2,1H3,(H,17,19) |
| InChIKey | ZIALKQVIXWWZLP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|