C19H21N3O2 — CID 31959852
N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2-(2-methyl-1H-indol-3-yl)acetamide (PubChem CID 31959852) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2-(2-methyl-1H-indol-3-yl)acetamide.
| Compound Name | N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2-(2-methyl-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 31959852 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-2-(2-methyl-1H-indol-3-yl)acetamide |
| SMILES | Cc1cc(C)c(CNC(=O)Cc2c(C)[nH]c3ccccc23)c(=O)[nH]1 |
| InChI | InChI=1S/C19H21N3O2/c1-11-8-12(2)21-19(24)16(11)10-20-18(23)9-15-13(3)22-17-7-5-4-6-14(15)17/h4-8,22H,9-10H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | IRNLQWMUTYSISE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|