C15H18N4O5 — CID 120698655
2-[4-[[[2-(2-methoxyethoxy)benzoyl]amino]methyl]triazol-1-yl]acetic acid (PubChem CID 120698655) has the molecular formula C15H18N4O5 and a molecular weight of 334.33 g/mol. Its IUPAC name is 2-[4-[[[2-(2-methoxyethoxy)benzoyl]amino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[[2-(2-methoxyethoxy)benzoyl]amino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 120698655 |
| Molecular Formula | C15H18N4O5 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-[4-[[[2-(2-methoxyethoxy)benzoyl]amino]methyl]triazol-1-yl]acetic acid |
| SMILES | COCCOc1ccccc1C(=O)NCc1cn(CC(=O)O)nn1 |
| InChI | InChI=1S/C15H18N4O5/c1-23-6-7-24-13-5-3-2-4-12(13)15(22)16-8-11-9-19(18-17-11)10-14(20)21/h2-5,9H,6-8,10H2,1H3,(H,16,22)(H,20,21) |
| InChIKey | UNNBKEKOZAPTOC-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|