C12H14N4O4S — CID 120698974
2-[4-[[[3-(methoxymethyl)thiophene-2-carbonyl]amino]methyl]triazol-1-yl]acetic acid (PubChem CID 120698974) has the molecular formula C12H14N4O4S and a molecular weight of 310.34 g/mol. Its IUPAC name is 2-[4-[[[3-(methoxymethyl)thiophene-2-carbonyl]amino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[[3-(methoxymethyl)thiophene-2-carbonyl]amino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 120698974 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 2-[4-[[[3-(methoxymethyl)thiophene-2-carbonyl]amino]methyl]triazol-1-yl]acetic acid |
| SMILES | COCc1ccsc1C(=O)NCc1cn(CC(=O)O)nn1 |
| InChI | InChI=1S/C12H14N4O4S/c1-20-7-8-2-3-21-11(8)12(19)13-4-9-5-16(15-14-9)6-10(17)18/h2-3,5H,4,6-7H2,1H3,(H,13,19)(H,17,18) |
| InChIKey | MSBADQUYUATRDU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |