C11H12N4O3S2 — CID 120698719
2-[4-[[(3-methylsulfanylthiophene-2-carbonyl)amino]methyl]triazol-1-yl]acetic acid (PubChem CID 120698719) has the molecular formula C11H12N4O3S2 and a molecular weight of 312.38 g/mol. Its IUPAC name is 2-[4-[[(3-methylsulfanylthiophene-2-carbonyl)amino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[(3-methylsulfanylthiophene-2-carbonyl)amino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 120698719 |
| Molecular Formula | C11H12N4O3S2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 2-[4-[[(3-methylsulfanylthiophene-2-carbonyl)amino]methyl]triazol-1-yl]acetic acid |
| SMILES | CSc1ccsc1C(=O)NCc1cn(CC(=O)O)nn1 |
| InChI | InChI=1S/C11H12N4O3S2/c1-19-8-2-3-20-10(8)11(18)12-4-7-5-15(14-13-7)6-9(16)17/h2-3,5H,4,6H2,1H3,(H,12,18)(H,16,17) |
| InChIKey | GUEZTSBUHPYMTB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |