C11H15NO4S2 — CID 120526415
2-[2-[[3-(methoxymethyl)thiophene-2-carbonyl]amino]ethylsulfanyl]acetic acid (PubChem CID 120526415) has the molecular formula C11H15NO4S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 2-[2-[[3-(methoxymethyl)thiophene-2-carbonyl]amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[[3-(methoxymethyl)thiophene-2-carbonyl]amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 120526415 |
| Molecular Formula | C11H15NO4S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 2-[2-[[3-(methoxymethyl)thiophene-2-carbonyl]amino]ethylsulfanyl]acetic acid |
| SMILES | COCc1ccsc1C(=O)NCCSCC(=O)O |
| InChI | InChI=1S/C11H15NO4S2/c1-16-6-8-2-4-18-10(8)11(15)12-3-5-17-7-9(13)14/h2,4H,3,5-7H2,1H3,(H,12,15)(H,13,14) |
| InChIKey | ZHVWBZSZIFODKG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|