C15H15N5O5 — CID 120698776
2-[4-[[[2-(4-cyano-2-methoxyphenoxy)acetyl]amino]methyl]triazol-1-yl]acetic acid (PubChem CID 120698776) has the molecular formula C15H15N5O5 and a molecular weight of 345.32 g/mol. Its IUPAC name is 2-[4-[[[2-(4-cyano-2-methoxyphenoxy)acetyl]amino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[[2-(4-cyano-2-methoxyphenoxy)acetyl]amino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 120698776 |
| Molecular Formula | C15H15N5O5 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2-[4-[[[2-(4-cyano-2-methoxyphenoxy)acetyl]amino]methyl]triazol-1-yl]acetic acid |
| SMILES | COc1cc(C#N)ccc1OCC(=O)NCc1cn(CC(=O)O)nn1 |
| InChI | InChI=1S/C15H15N5O5/c1-24-13-4-10(5-16)2-3-12(13)25-9-14(21)17-6-11-7-20(19-18-11)8-15(22)23/h2-4,7H,6,8-9H2,1H3,(H,17,21)(H,22,23) |
| InChIKey | RUYLQNZWJZXEII-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 139.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |