C17H22N2O5 — CID 119252697
2-[[[2-(4-cyano-2-methoxyphenoxy)acetyl]amino]methyl]-4-methylpentanoic acid (PubChem CID 119252697) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is 2-[[[2-(4-cyano-2-methoxyphenoxy)acetyl]amino]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[[2-(4-cyano-2-methoxyphenoxy)acetyl]amino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119252697 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2-[[[2-(4-cyano-2-methoxyphenoxy)acetyl]amino]methyl]-4-methylpentanoic acid |
| SMILES | COc1cc(C#N)ccc1OCC(=O)NCC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C17H22N2O5/c1-11(2)6-13(17(21)22)9-19-16(20)10-24-14-5-4-12(8-18)7-15(14)23-3/h4-5,7,11,13H,6,9-10H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | BPPXENRDXIDZJA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |