C14H16N2O5 — CID 119220599
3-[[2-(4-cyano-2-methoxyphenoxy)acetyl]amino]butanoic acid (PubChem CID 119220599) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is 3-[[2-(4-cyano-2-methoxyphenoxy)acetyl]amino]butanoic acid.
| Compound Name | 3-[[2-(4-cyano-2-methoxyphenoxy)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119220599 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 3-[[2-(4-cyano-2-methoxyphenoxy)acetyl]amino]butanoic acid |
| SMILES | COc1cc(C#N)ccc1OCC(=O)NC(C)CC(=O)O |
| InChI | InChI=1S/C14H16N2O5/c1-9(5-14(18)19)16-13(17)8-21-11-4-3-10(7-15)6-12(11)20-2/h3-4,6,9H,5,8H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | XFNOERLWRLSZPW-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |