C17H22N4O5 — CID 120698966
2-[4-[[[2-[3-(2-methylpropoxy)phenoxy]acetyl]amino]methyl]triazol-1-yl]acetic acid (PubChem CID 120698966) has the molecular formula C17H22N4O5 and a molecular weight of 362.39 g/mol. Its IUPAC name is 2-[4-[[[2-[3-(2-methylpropoxy)phenoxy]acetyl]amino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[[2-[3-(2-methylpropoxy)phenoxy]acetyl]amino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 120698966 |
| Molecular Formula | C17H22N4O5 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 2-[4-[[[2-[3-(2-methylpropoxy)phenoxy]acetyl]amino]methyl]triazol-1-yl]acetic acid |
| SMILES | CC(C)COc1cccc(OCC(=O)NCc2cn(CC(=O)O)nn2)c1 |
| InChI | InChI=1S/C17H22N4O5/c1-12(2)10-25-14-4-3-5-15(6-14)26-11-16(22)18-7-13-8-21(20-19-13)9-17(23)24/h3-6,8,12H,7,9-11H2,1-2H3,(H,18,22)(H,23,24) |
| InChIKey | FEUZPQRPWIMXOZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |