C17H22N4O4 — CID 120698762
2-[4-[[2-(3-propan-2-ylphenoxy)propanoylamino]methyl]triazol-1-yl]acetic acid (PubChem CID 120698762) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-[4-[[2-(3-propan-2-ylphenoxy)propanoylamino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[2-(3-propan-2-ylphenoxy)propanoylamino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 120698762 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 2-[4-[[2-(3-propan-2-ylphenoxy)propanoylamino]methyl]triazol-1-yl]acetic acid |
| SMILES | CC(Oc1cccc(C(C)C)c1)C(=O)NCc1cn(CC(=O)O)nn1 |
| InChI | InChI=1S/C17H22N4O4/c1-11(2)13-5-4-6-15(7-13)25-12(3)17(24)18-8-14-9-21(20-19-14)10-16(22)23/h4-7,9,11-12H,8,10H2,1-3H3,(H,18,24)(H,22,23) |
| InChIKey | ZUXYFBXKEJYFTC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |