C11H19N5O3 — CID 115458155
2-[4-[[2-(aminomethyl)pentanoylamino]methyl]triazol-1-yl]acetic acid (PubChem CID 115458155) has the molecular formula C11H19N5O3 and a molecular weight of 269.31 g/mol. Its IUPAC name is 2-[4-[[2-(aminomethyl)pentanoylamino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[2-(aminomethyl)pentanoylamino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 115458155 |
| Molecular Formula | C11H19N5O3 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 2-[4-[[2-(aminomethyl)pentanoylamino]methyl]triazol-1-yl]acetic acid |
| SMILES | CCCC(CN)C(=O)NCc1cn(CC(=O)O)nn1 |
| InChI | InChI=1S/C11H19N5O3/c1-2-3-8(4-12)11(19)13-5-9-6-16(15-14-9)7-10(17)18/h6,8H,2-5,7,12H2,1H3,(H,13,19)(H,17,18) |
| InChIKey | ZPMJAEANGKFABT-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |