C15H17BrN4O4 — CID 120698942
2-[4-[[4-(3-bromophenoxy)butanoylamino]methyl]triazol-1-yl]acetic acid (PubChem CID 120698942) has the molecular formula C15H17BrN4O4 and a molecular weight of 397.23 g/mol. Its IUPAC name is 2-[4-[[4-(3-bromophenoxy)butanoylamino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[4-(3-bromophenoxy)butanoylamino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 120698942 |
| Molecular Formula | C15H17BrN4O4 |
| Molecular Weight | 397.23 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 2-[4-[[4-(3-bromophenoxy)butanoylamino]methyl]triazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(CNC(=O)CCCOc2cccc(Br)c2)nn1 |
| InChI | InChI=1S/C15H17BrN4O4/c16-11-3-1-4-13(7-11)24-6-2-5-14(21)17-8-12-9-20(19-18-12)10-15(22)23/h1,3-4,7,9H,2,5-6,8,10H2,(H,17,21)(H,22,23) |
| InChIKey | HKFDZMYANCNEAE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|