C19H24N4O4 — CID 120698424
2-[4-[[3-(3-cyclopentyloxyphenyl)propanoylamino]methyl]triazol-1-yl]acetic acid (PubChem CID 120698424) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is 2-[4-[[3-(3-cyclopentyloxyphenyl)propanoylamino]methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[3-(3-cyclopentyloxyphenyl)propanoylamino]methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 120698424 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-[4-[[3-(3-cyclopentyloxyphenyl)propanoylamino]methyl]triazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(CNC(=O)CCc2cccc(OC3CCCC3)c2)nn1 |
| InChI | InChI=1S/C19H24N4O4/c24-18(20-11-15-12-23(22-21-15)13-19(25)26)9-8-14-4-3-7-17(10-14)27-16-5-1-2-6-16/h3-4,7,10,12,16H,1-2,5-6,8-9,11,13H2,(H,20,24)(H,25,26) |
| InChIKey | HPQMOXKBEJMVTH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |