C21H29NO4 — CID 119229659
4-[3-(3-cyclopentyloxyphenyl)propanoylamino]cyclohexane-1-carboxylic acid (PubChem CID 119229659) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is 4-[3-(3-cyclopentyloxyphenyl)propanoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[3-(3-cyclopentyloxyphenyl)propanoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 119229659 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 4-[3-(3-cyclopentyloxyphenyl)propanoylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(CCc1cccc(OC2CCCC2)c1)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C21H29NO4/c23-20(22-17-11-9-16(10-12-17)21(24)25)13-8-15-4-3-7-19(14-15)26-18-5-1-2-6-18/h3-4,7,14,16-18H,1-2,5-6,8-13H2,(H,22,23)(H,24,25) |
| InChIKey | BQKUOJDVLBVSOF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |