C24H29NO4 — CID 166378121
2-[3-(3-cyclopentyloxyphenyl)propanoylamino]-2-(3,4-dimethylphenyl)acetic acid (PubChem CID 166378121) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is 2-[3-(3-cyclopentyloxyphenyl)propanoylamino]-2-(3,4-dimethylphenyl)acetic acid.
| Compound Name | 2-[3-(3-cyclopentyloxyphenyl)propanoylamino]-2-(3,4-dimethylphenyl)acetic acid |
|---|---|
| PubChem CID | 166378121 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 2-[3-(3-cyclopentyloxyphenyl)propanoylamino]-2-(3,4-dimethylphenyl)acetic acid |
| SMILES | Cc1ccc(C(NC(=O)CCc2cccc(OC3CCCC3)c2)C(=O)O)cc1C |
| InChI | InChI=1S/C24H29NO4/c1-16-10-12-19(14-17(16)2)23(24(27)28)25-22(26)13-11-18-6-5-9-21(15-18)29-20-7-3-4-8-20/h5-6,9-10,12,14-15,20,23H,3-4,7-8,11,13H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | ZDHCPDYTFSVAAJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |