2-[3-(3,5-dimethoxyphenyl)propanoylamino]-2-phenylacetic acid

C19H21NO5 — CID 119113378

IUPAC2-[3-(3,5-dimethoxyphenyl)propanoylamino]-2-phenylacetic acid
SMILESCOc1cc(CCC(=O)NC(C(=O)O)c2ccccc2)cc(OC)c1
InChIInChI=1S/C19H21NO5/c1-24-15-10-13(11-16(12-15)25-2)8-9-17(21)20-18(19(22)23)14-6-4-3-5-7-14/h3-7,10-12,18H,8-9H2,1-2H3,(H,20,21)(H,22,23)
InChIKeyPHHFGSNACAWTAZ-UHFFFAOYSA-N
MW343.38 g/mol
LogP2.58
Rot. Bonds8

About 2-[3-(3,5-dimethoxyphenyl)propanoylamino]-2-phenylacetic acid

2-[3-(3,5-dimethoxyphenyl)propanoylamino]-2-phenylacetic acid (PubChem CID 119113378) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-[3-(3,5-dimethoxyphenyl)propanoylamino]-2-phenylacetic acid.

Molecular Properties

Compound Name2-[3-(3,5-dimethoxyphenyl)propanoylamino]-2-phenylacetic acid
PubChem CID119113378
Molecular FormulaC19H21NO5
Molecular Weight343.38 g/mol
Exact Mass343.14
IUPAC Name2-[3-(3,5-dimethoxyphenyl)propanoylamino]-2-phenylacetic acid
SMILESCOc1cc(CCC(=O)NC(C(=O)O)c2ccccc2)cc(OC)c1
InChIInChI=1S/C19H21NO5/c1-24-15-10-13(11-16(12-15)25-2)8-9-17(21)20-18(19(22)23)14-6-4-3-5-7-14/h3-7,10-12,18H,8-9H2,1-2H3,(H,20,21)(H,22,23)
InChIKeyPHHFGSNACAWTAZ-UHFFFAOYSA-N
XLogP2.58
TPSA84.86 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500343.38
LogP ≤ 52.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[3-(3,5-dimethoxyphenyl)propanoylamino]-2-phenylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(3,5-dimethoxyphenyl)propanoylamino]-2-phenylacetic acid?
The IUPAC name of 2-[3-(3,5-dimethoxyphenyl)propanoylamino]-2-phenylacetic acid (CID 119113378) is 2-[3-(3,5-dimethoxyphenyl)propanoylamino]-2-phenylacetic acid.
What is the SMILES notation for 2-[3-(3,5-dimethoxyphenyl)propanoylamino]-2-phenylacetic acid?
The canonical SMILES for 2-[3-(3,5-dimethoxyphenyl)propanoylamino]-2-phenylacetic acid is COc1cc(CCC(=O)NC(C(=O)O)c2ccccc2)cc(OC)c1.
What is the InChIKey of 2-[3-(3,5-dimethoxyphenyl)propanoylamino]-2-phenylacetic acid?
The InChIKey is PHHFGSNACAWTAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO5/c1-24-15-10-13(11-16(12-15)25-2)8-9-17(21)20-18(19(22)23)14-6-4-3-5-7-14/h3-7,10-12,18H,8-9H2,1-2H3,(H,20,21)(H,22,23).
What are the key properties of 2-[3-(3,5-dimethoxyphenyl)propanoylamino]-2-phenylacetic acid?
2-[3-(3,5-dimethoxyphenyl)propanoylamino]-2-phenylacetic acid has a molecular weight of 343.38 g/mol, XLogP of 2.58, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3,5-dimethoxyphenyl)propanoylamino]-2-phenylacetic acid is sourced from PubChem (CID 119113378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).