C15H15NO3S — CID 99849615
(2R)-2-phenyl-2-(3-thiophen-3-ylpropanoylamino)acetic acid (PubChem CID 99849615) has the molecular formula C15H15NO3S and a molecular weight of 289.36 g/mol. Its IUPAC name is (2R)-2-phenyl-2-(3-thiophen-3-ylpropanoylamino)acetic acid.
| Compound Name | (2R)-2-phenyl-2-(3-thiophen-3-ylpropanoylamino)acetic acid |
|---|---|
| PubChem CID | 99849615 |
| Molecular Formula | C15H15NO3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | (2R)-2-phenyl-2-(3-thiophen-3-ylpropanoylamino)acetic acid |
| SMILES | O=C(CCc1ccsc1)N[C@@H](C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C15H15NO3S/c17-13(7-6-11-8-9-20-10-11)16-14(15(18)19)12-4-2-1-3-5-12/h1-5,8-10,14H,6-7H2,(H,16,17)(H,18,19)/t14-/m1/s1 |
| InChIKey | UNRSWUCEOYYYGC-CQSZACIVSA-N |
| XLogP | 2.62 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |