C22H19NO2S — CID 51644623
N-[(R)-1-benzofuran-2-yl(phenyl)methyl]-3-thiophen-3-ylpropanamide (PubChem CID 51644623) has the molecular formula C22H19NO2S and a molecular weight of 361.47 g/mol. Its IUPAC name is N-[(R)-1-benzofuran-2-yl(phenyl)methyl]-3-thiophen-3-ylpropanamide.
| Compound Name | N-[(R)-1-benzofuran-2-yl(phenyl)methyl]-3-thiophen-3-ylpropanamide |
|---|---|
| PubChem CID | 51644623 |
| Molecular Formula | C22H19NO2S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | N-[(R)-1-benzofuran-2-yl(phenyl)methyl]-3-thiophen-3-ylpropanamide |
| SMILES | O=C(CCc1ccsc1)N[C@H](c1ccccc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C22H19NO2S/c24-21(11-10-16-12-13-26-15-16)23-22(17-6-2-1-3-7-17)20-14-18-8-4-5-9-19(18)25-20/h1-9,12-15,22H,10-11H2,(H,23,24)/t22-/m1/s1 |
| InChIKey | WPUWVDWDWLNVSR-JOCHJYFZSA-N |
| XLogP | 5.33 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |