C10H13NO3S — CID 115731118
2-(3-thiophen-3-ylpropanoylamino)propanoic acid (PubChem CID 115731118) has the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. Its IUPAC name is 2-(3-thiophen-3-ylpropanoylamino)propanoic acid.
| Compound Name | 2-(3-thiophen-3-ylpropanoylamino)propanoic acid |
|---|---|
| PubChem CID | 115731118 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 2-(3-thiophen-3-ylpropanoylamino)propanoic acid |
| SMILES | CC(NC(=O)CCc1ccsc1)C(=O)O |
| InChI | InChI=1S/C10H13NO3S/c1-7(10(13)14)11-9(12)3-2-8-4-5-15-6-8/h4-7H,2-3H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | KWIZNTTZDIAPMH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |