C8H11NO2S — CID 51883451
(2R)-2-(thiophen-3-ylmethylamino)propanoic acid (PubChem CID 51883451) has the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. Its IUPAC name is (2R)-2-(thiophen-3-ylmethylamino)propanoic acid.
| Compound Name | (2R)-2-(thiophen-3-ylmethylamino)propanoic acid |
|---|---|
| PubChem CID | 51883451 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | (2R)-2-(thiophen-3-ylmethylamino)propanoic acid |
| SMILES | C[C@@H](NCc1ccsc1)C(=O)O |
| InChI | InChI=1S/C8H11NO2S/c1-6(8(10)11)9-4-7-2-3-12-5-7/h2-3,5-6,9H,4H2,1H3,(H,10,11)/t6-/m1/s1 |
| InChIKey | OIDWAMZBNCKPCX-ZCFIWIBFSA-N |
| XLogP | 1.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |