C8H13NO2S — CID 65312761
2-(thiophen-3-ylmethylamino)propane-1,3-diol (PubChem CID 65312761) has the molecular formula C8H13NO2S and a molecular weight of 187.26 g/mol. Its IUPAC name is 2-(thiophen-3-ylmethylamino)propane-1,3-diol.
| Compound Name | 2-(thiophen-3-ylmethylamino)propane-1,3-diol |
|---|---|
| PubChem CID | 65312761 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 2-(thiophen-3-ylmethylamino)propane-1,3-diol |
| SMILES | OCC(CO)NCc1ccsc1 |
| InChI | InChI=1S/C8H13NO2S/c10-4-8(5-11)9-3-7-1-2-12-6-7/h1-2,6,8-11H,3-5H2 |
| InChIKey | CBMJSONSXIYJCO-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |