C10H18N2OS — CID 4723865
1-[2-(thiophen-3-ylmethylamino)ethylamino]propan-2-ol (PubChem CID 4723865) has the molecular formula C10H18N2OS and a molecular weight of 214.33 g/mol. Its IUPAC name is 1-[2-(thiophen-3-ylmethylamino)ethylamino]propan-2-ol.
| Compound Name | 1-[2-(thiophen-3-ylmethylamino)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 4723865 |
| Molecular Formula | C10H18N2OS |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 1-[2-(thiophen-3-ylmethylamino)ethylamino]propan-2-ol |
| SMILES | CC(O)CNCCNCc1ccsc1 |
| InChI | InChI=1S/C10H18N2OS/c1-9(13)6-11-3-4-12-7-10-2-5-14-8-10/h2,5,8-9,11-13H,3-4,6-7H2,1H3 |
| InChIKey | LMBZZIDJJHPNAS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|