C10H18N2OS — CID 63248312
1-(dimethylamino)-3-(thiophen-3-ylmethylamino)propan-2-ol (PubChem CID 63248312) has the molecular formula C10H18N2OS and a molecular weight of 214.33 g/mol. Its IUPAC name is 1-(dimethylamino)-3-(thiophen-3-ylmethylamino)propan-2-ol.
| Compound Name | 1-(dimethylamino)-3-(thiophen-3-ylmethylamino)propan-2-ol |
|---|---|
| PubChem CID | 63248312 |
| Molecular Formula | C10H18N2OS |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 1-(dimethylamino)-3-(thiophen-3-ylmethylamino)propan-2-ol |
| SMILES | CN(C)CC(O)CNCc1ccsc1 |
| InChI | InChI=1S/C10H18N2OS/c1-12(2)7-10(13)6-11-5-9-3-4-14-8-9/h3-4,8,10-11,13H,5-7H2,1-2H3 |
| InChIKey | BFXKGUIOWOXANX-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |