About 1-cyclopropyl-N,N-dimethyl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine;hydrochloride
1-cyclopropyl-N,N-dimethyl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine;hydrochloride (PubChem CID 115584787) has the molecular formula C12H21ClN2S
and a molecular weight of 260.83 g/mol. Its IUPAC name is 1-cyclopropyl-N,N-dimethyl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine;hydrochloride.
Molecular Properties
| Compound Name | 1-cyclopropyl-N,N-dimethyl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine;hydrochloride |
| PubChem CID | 115584787 |
| Molecular Formula | C12H21ClN2S |
| Molecular Weight | 260.83 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 1-cyclopropyl-N,N-dimethyl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine;hydrochloride |
| SMILES | CN(C)C(CNCc1ccsc1)C1CC1.Cl |
| InChI | InChI=1S/C12H20N2S.ClH/c1-14(2)12(11-3-4-11)8-13-7-10-5-6-15-9-10;/h5-6,9,11-13H,3-4,7-8H2,1-2H3;1H |
| InChIKey | YDQIFQTVZLHCKC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.83 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclopropyl-N,N-dimethyl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-N,N-dimethyl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine;hydrochloride?
The IUPAC name of 1-cyclopropyl-N,N-dimethyl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine;hydrochloride (CID 115584787) is 1-cyclopropyl-N,N-dimethyl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine;hydrochloride.
What is the SMILES notation for 1-cyclopropyl-N,N-dimethyl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine;hydrochloride?
The canonical SMILES for 1-cyclopropyl-N,N-dimethyl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine;hydrochloride is CN(C)C(CNCc1ccsc1)C1CC1.Cl.
What is the InChIKey of 1-cyclopropyl-N,N-dimethyl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine;hydrochloride?
The InChIKey is YDQIFQTVZLHCKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2S.ClH/c1-14(2)12(11-3-4-11)8-13-7-10-5-6-15-9-10;/h5-6,9,11-13H,3-4,7-8H2,1-2H3;1H.
What are the key properties of 1-cyclopropyl-N,N-dimethyl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine;hydrochloride?
1-cyclopropyl-N,N-dimethyl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine;hydrochloride has a molecular weight of 260.83 g/mol, XLogP of 2.60, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-N,N-dimethyl-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine;hydrochloride is sourced from PubChem (CID 115584787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).