C12H22N2OS — CID 63248314
1-(diethylamino)-3-(thiophen-3-ylmethylamino)propan-2-ol (PubChem CID 63248314) has the molecular formula C12H22N2OS and a molecular weight of 242.39 g/mol. Its IUPAC name is 1-(diethylamino)-3-(thiophen-3-ylmethylamino)propan-2-ol.
| Compound Name | 1-(diethylamino)-3-(thiophen-3-ylmethylamino)propan-2-ol |
|---|---|
| PubChem CID | 63248314 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 1-(diethylamino)-3-(thiophen-3-ylmethylamino)propan-2-ol |
| SMILES | CCN(CC)CC(O)CNCc1ccsc1 |
| InChI | InChI=1S/C12H22N2OS/c1-3-14(4-2)9-12(15)8-13-7-11-5-6-16-10-11/h5-6,10,12-13,15H,3-4,7-9H2,1-2H3 |
| InChIKey | NWMMYIVZLXIWLI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |