C21H30N4S3 — CID 100933177
N-(thiophen-3-ylmethyl)-N',N'-bis[2-(thiophen-3-ylmethylamino)ethyl]ethane-1,2-diamine (PubChem CID 100933177) has the molecular formula C21H30N4S3 and a molecular weight of 434.70 g/mol. Its IUPAC name is N-(thiophen-3-ylmethyl)-N',N'-bis[2-(thiophen-3-ylmethylamino)ethyl]ethane-1,2-diamine.
| Compound Name | N-(thiophen-3-ylmethyl)-N',N'-bis[2-(thiophen-3-ylmethylamino)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 100933177 |
| Molecular Formula | C21H30N4S3 |
| Molecular Weight | 434.70 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | N-(thiophen-3-ylmethyl)-N',N'-bis[2-(thiophen-3-ylmethylamino)ethyl]ethane-1,2-diamine |
| SMILES | c1cc(CNCCN(CCNCc2ccsc2)CCNCc2ccsc2)cs1 |
| InChI | InChI=1S/C21H30N4S3/c1-10-26-16-19(1)13-22-4-7-25(8-5-23-14-20-2-11-27-17-20)9-6-24-15-21-3-12-28-18-21/h1-3,10-12,16-18,22-24H,4-9,13-15H2 |
| InChIKey | NXBULDUGRFJNQQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.70 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|