C15H20N2OS — CID 62553956
N'-cyclopropyl-N-(furan-3-ylmethyl)-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine (PubChem CID 62553956) has the molecular formula C15H20N2OS and a molecular weight of 276.40 g/mol. Its IUPAC name is N'-cyclopropyl-N-(furan-3-ylmethyl)-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-cyclopropyl-N-(furan-3-ylmethyl)-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62553956 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | N'-cyclopropyl-N-(furan-3-ylmethyl)-N'-(thiophen-3-ylmethyl)ethane-1,2-diamine |
| SMILES | c1cc(CNCCN(Cc2ccsc2)C2CC2)co1 |
| InChI | InChI=1S/C15H20N2OS/c1-2-15(1)17(10-14-4-8-19-12-14)6-5-16-9-13-3-7-18-11-13/h3-4,7-8,11-12,15-16H,1-2,5-6,9-10H2 |
| InChIKey | NOJZAMYMBJCACP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|