C14H23NOS — CID 103737857
6-[cyclopropyl(thiophen-3-ylmethyl)amino]hexan-1-ol (PubChem CID 103737857) has the molecular formula C14H23NOS and a molecular weight of 253.41 g/mol. Its IUPAC name is 6-[cyclopropyl(thiophen-3-ylmethyl)amino]hexan-1-ol.
| Compound Name | 6-[cyclopropyl(thiophen-3-ylmethyl)amino]hexan-1-ol |
|---|---|
| PubChem CID | 103737857 |
| Molecular Formula | C14H23NOS |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 6-[cyclopropyl(thiophen-3-ylmethyl)amino]hexan-1-ol |
| SMILES | OCCCCCCN(Cc1ccsc1)C1CC1 |
| InChI | InChI=1S/C14H23NOS/c16-9-4-2-1-3-8-15(14-5-6-14)11-13-7-10-17-12-13/h7,10,12,14,16H,1-6,8-9,11H2 |
| InChIKey | NDUZQGUKTCWAAR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|