C17H22N2S — CID 62563786
N'-cyclopropyl-N-phenyl-N'-(thiophen-3-ylmethyl)propane-1,3-diamine (PubChem CID 62563786) has the molecular formula C17H22N2S and a molecular weight of 286.44 g/mol. Its IUPAC name is N'-cyclopropyl-N-phenyl-N'-(thiophen-3-ylmethyl)propane-1,3-diamine.
| Compound Name | N'-cyclopropyl-N-phenyl-N'-(thiophen-3-ylmethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 62563786 |
| Molecular Formula | C17H22N2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | N'-cyclopropyl-N-phenyl-N'-(thiophen-3-ylmethyl)propane-1,3-diamine |
| SMILES | c1ccc(NCCCN(Cc2ccsc2)C2CC2)cc1 |
| InChI | InChI=1S/C17H22N2S/c1-2-5-16(6-3-1)18-10-4-11-19(17-7-8-17)13-15-9-12-20-14-15/h1-3,5-6,9,12,14,17-18H,4,7-8,10-11,13H2 |
| InChIKey | DFPYGPISAOISQC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|