C16H19NOS2 — CID 62035879
4-[cyclopropyl(thiophen-3-ylmethyl)amino]-1-thiophen-2-ylbutan-1-one (PubChem CID 62035879) has the molecular formula C16H19NOS2 and a molecular weight of 305.47 g/mol. Its IUPAC name is 4-[cyclopropyl(thiophen-3-ylmethyl)amino]-1-thiophen-2-ylbutan-1-one.
| Compound Name | 4-[cyclopropyl(thiophen-3-ylmethyl)amino]-1-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 62035879 |
| Molecular Formula | C16H19NOS2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 4-[cyclopropyl(thiophen-3-ylmethyl)amino]-1-thiophen-2-ylbutan-1-one |
| SMILES | O=C(CCCN(Cc1ccsc1)C1CC1)c1cccs1 |
| InChI | InChI=1S/C16H19NOS2/c18-15(16-4-2-9-20-16)3-1-8-17(14-5-6-14)11-13-7-10-19-12-13/h2,4,7,9-10,12,14H,1,3,5-6,8,11H2 |
| InChIKey | ZEEFVUKRBPXMNA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |