C10H14ClNS — CID 61435255
N-(2-chloroethyl)-N-(thiophen-3-ylmethyl)cyclopropanamine (PubChem CID 61435255) has the molecular formula C10H14ClNS and a molecular weight of 215.75 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-(thiophen-3-ylmethyl)cyclopropanamine.
| Compound Name | N-(2-chloroethyl)-N-(thiophen-3-ylmethyl)cyclopropanamine |
|---|---|
| PubChem CID | 61435255 |
| Molecular Formula | C10H14ClNS |
| Molecular Weight | 215.75 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | N-(2-chloroethyl)-N-(thiophen-3-ylmethyl)cyclopropanamine |
| SMILES | ClCCN(Cc1ccsc1)C1CC1 |
| InChI | InChI=1S/C10H14ClNS/c11-4-5-12(10-1-2-10)7-9-3-6-13-8-9/h3,6,8,10H,1-2,4-5,7H2 |
| InChIKey | WFIJWPOKRLKWEO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.75 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|