C15H16INS — CID 65478755
N-[(4-iodophenyl)methyl]-N-(thiophen-3-ylmethyl)cyclopropanamine (PubChem CID 65478755) has the molecular formula C15H16INS and a molecular weight of 369.27 g/mol. Its IUPAC name is N-[(4-iodophenyl)methyl]-N-(thiophen-3-ylmethyl)cyclopropanamine.
| Compound Name | N-[(4-iodophenyl)methyl]-N-(thiophen-3-ylmethyl)cyclopropanamine |
|---|---|
| PubChem CID | 65478755 |
| Molecular Formula | C15H16INS |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | N-[(4-iodophenyl)methyl]-N-(thiophen-3-ylmethyl)cyclopropanamine |
| SMILES | Ic1ccc(CN(Cc2ccsc2)C2CC2)cc1 |
| InChI | InChI=1S/C15H16INS/c16-14-3-1-12(2-4-14)9-17(15-5-6-15)10-13-7-8-18-11-13/h1-4,7-8,11,15H,5-6,9-10H2 |
| InChIKey | MGOHPSVIMUDRFH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|