C14H15ClN2S — CID 61434645
N-[(6-chloro-3-pyridinyl)methyl]-N-(thiophen-3-ylmethyl)cyclopropanamine (PubChem CID 61434645) has the molecular formula C14H15ClN2S and a molecular weight of 278.81 g/mol. Its IUPAC name is N-[(6-chloro-3-pyridinyl)methyl]-N-(thiophen-3-ylmethyl)cyclopropanamine.
| Compound Name | N-[(6-chloro-3-pyridinyl)methyl]-N-(thiophen-3-ylmethyl)cyclopropanamine |
|---|---|
| PubChem CID | 61434645 |
| Molecular Formula | C14H15ClN2S |
| Molecular Weight | 278.81 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | N-[(6-chloro-3-pyridinyl)methyl]-N-(thiophen-3-ylmethyl)cyclopropanamine |
| SMILES | Clc1ccc(CN(Cc2ccsc2)C2CC2)cn1 |
| InChI | InChI=1S/C14H15ClN2S/c15-14-4-1-11(7-16-14)8-17(13-2-3-13)9-12-5-6-18-10-12/h1,4-7,10,13H,2-3,8-9H2 |
| InChIKey | GIWHUQSCJXFOJJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.81 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|