C19H23ClN2O2 — CID 111434936
3-[[(6-chloro-3-pyridinyl)methyl-(4-hydroxycyclohexyl)amino]methyl]phenol (PubChem CID 111434936) has the molecular formula C19H23ClN2O2 and a molecular weight of 346.86 g/mol. Its IUPAC name is 3-[[(6-chloro-3-pyridinyl)methyl-(4-hydroxycyclohexyl)amino]methyl]phenol.
| Compound Name | 3-[[(6-chloro-3-pyridinyl)methyl-(4-hydroxycyclohexyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 111434936 |
| Molecular Formula | C19H23ClN2O2 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 3-[[(6-chloro-3-pyridinyl)methyl-(4-hydroxycyclohexyl)amino]methyl]phenol |
| SMILES | Oc1cccc(CN(Cc2ccc(Cl)nc2)C2CCC(O)CC2)c1 |
| InChI | InChI=1S/C19H23ClN2O2/c20-19-9-4-15(11-21-19)13-22(16-5-7-17(23)8-6-16)12-14-2-1-3-18(24)10-14/h1-4,9-11,16-17,23-24H,5-8,12-13H2 |
| InChIKey | SPWRFYBBVZMELM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 56.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|