N-cyclopropyl-N-(thiophen-3-ylmethyl)carbamoyl chloride

C9H10ClNOS — CID 79887165

IUPACN-cyclopropyl-N-(thiophen-3-ylmethyl)carbamoyl chloride
SMILESO=C(Cl)N(Cc1ccsc1)C1CC1
InChIInChI=1S/C9H10ClNOS/c10-9(12)11(8-1-2-8)5-7-3-4-13-6-7/h3-4,6,8H,1-2,5H2
InChIKeyAENGBUGVKLRFCM-UHFFFAOYSA-N
MW215.70 g/mol
LogP3.07
Rot. Bonds3

About N-cyclopropyl-N-(thiophen-3-ylmethyl)carbamoyl chloride

N-cyclopropyl-N-(thiophen-3-ylmethyl)carbamoyl chloride (PubChem CID 79887165) has the molecular formula C9H10ClNOS and a molecular weight of 215.70 g/mol. Its IUPAC name is N-cyclopropyl-N-(thiophen-3-ylmethyl)carbamoyl chloride.

Molecular Properties

Compound NameN-cyclopropyl-N-(thiophen-3-ylmethyl)carbamoyl chloride
PubChem CID79887165
Molecular FormulaC9H10ClNOS
Molecular Weight215.70 g/mol
Exact Mass215.02
IUPAC NameN-cyclopropyl-N-(thiophen-3-ylmethyl)carbamoyl chloride
SMILESO=C(Cl)N(Cc1ccsc1)C1CC1
InChIInChI=1S/C9H10ClNOS/c10-9(12)11(8-1-2-8)5-7-3-4-13-6-7/h3-4,6,8H,1-2,5H2
InChIKeyAENGBUGVKLRFCM-UHFFFAOYSA-N
XLogP3.07
TPSA20.31 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.70
LogP ≤ 53.07
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze N-cyclopropyl-N-(thiophen-3-ylmethyl)carbamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-cyclopropyl-N-(thiophen-3-ylmethyl)carbamoyl chloride?
The IUPAC name of N-cyclopropyl-N-(thiophen-3-ylmethyl)carbamoyl chloride (CID 79887165) is N-cyclopropyl-N-(thiophen-3-ylmethyl)carbamoyl chloride.
What is the SMILES notation for N-cyclopropyl-N-(thiophen-3-ylmethyl)carbamoyl chloride?
The canonical SMILES for N-cyclopropyl-N-(thiophen-3-ylmethyl)carbamoyl chloride is O=C(Cl)N(Cc1ccsc1)C1CC1.
What is the InChIKey of N-cyclopropyl-N-(thiophen-3-ylmethyl)carbamoyl chloride?
The InChIKey is AENGBUGVKLRFCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClNOS/c10-9(12)11(8-1-2-8)5-7-3-4-13-6-7/h3-4,6,8H,1-2,5H2.
What are the key properties of N-cyclopropyl-N-(thiophen-3-ylmethyl)carbamoyl chloride?
N-cyclopropyl-N-(thiophen-3-ylmethyl)carbamoyl chloride has a molecular weight of 215.70 g/mol, XLogP of 3.07, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N-(thiophen-3-ylmethyl)carbamoyl chloride is sourced from PubChem (CID 79887165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).