C15H22N2OS — CID 61167976
1-amino-N-cyclopropyl-N-(thiophen-3-ylmethyl)cyclohexane-1-carboxamide (PubChem CID 61167976) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is 1-amino-N-cyclopropyl-N-(thiophen-3-ylmethyl)cyclohexane-1-carboxamide.
| Compound Name | 1-amino-N-cyclopropyl-N-(thiophen-3-ylmethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 61167976 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 1-amino-N-cyclopropyl-N-(thiophen-3-ylmethyl)cyclohexane-1-carboxamide |
| SMILES | NC1(C(=O)N(Cc2ccsc2)C2CC2)CCCCC1 |
| InChI | InChI=1S/C15H22N2OS/c16-15(7-2-1-3-8-15)14(18)17(13-4-5-13)10-12-6-9-19-11-12/h6,9,11,13H,1-5,7-8,10,16H2 |
| InChIKey | KDHACJOVRWNOKI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |