C11H16N2OS — CID 61166609
2-amino-N-cyclopropyl-N-(thiophen-3-ylmethyl)propanamide (PubChem CID 61166609) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is 2-amino-N-cyclopropyl-N-(thiophen-3-ylmethyl)propanamide.
| Compound Name | 2-amino-N-cyclopropyl-N-(thiophen-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 61166609 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 2-amino-N-cyclopropyl-N-(thiophen-3-ylmethyl)propanamide |
| SMILES | CC(N)C(=O)N(Cc1ccsc1)C1CC1 |
| InChI | InChI=1S/C11H16N2OS/c1-8(12)11(14)13(10-2-3-10)6-9-4-5-15-7-9/h4-5,7-8,10H,2-3,6,12H2,1H3 |
| InChIKey | GEYGBINJHMYAGS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |