C14H21N3O2S — CID 76924821
N-cyclopropyl-2-(N'-hydroxycarbamimidoyl)-N-(thiophen-3-ylmethyl)pentanamide (PubChem CID 76924821) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is N-cyclopropyl-2-(N'-hydroxycarbamimidoyl)-N-(thiophen-3-ylmethyl)pentanamide.
| Compound Name | N-cyclopropyl-2-(N'-hydroxycarbamimidoyl)-N-(thiophen-3-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 76924821 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N-cyclopropyl-2-(N'-hydroxycarbamimidoyl)-N-(thiophen-3-ylmethyl)pentanamide |
| SMILES | CCCC(C(=O)N(Cc1ccsc1)C1CC1)C(N)=NO |
| InChI | InChI=1S/C14H21N3O2S/c1-2-3-12(13(15)16-19)14(18)17(11-4-5-11)8-10-6-7-20-9-10/h6-7,9,11-12,19H,2-5,8H2,1H3,(H2,15,16) |
| InChIKey | WKIVFQFBYHSXSE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|