C17H20ClNOS — CID 62630679
1-(4-chlorophenyl)-3-[cyclopropyl(thiophen-3-ylmethyl)amino]propan-1-ol (PubChem CID 62630679) has the molecular formula C17H20ClNOS and a molecular weight of 321.87 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[cyclopropyl(thiophen-3-ylmethyl)amino]propan-1-ol.
| Compound Name | 1-(4-chlorophenyl)-3-[cyclopropyl(thiophen-3-ylmethyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 62630679 |
| Molecular Formula | C17H20ClNOS |
| Molecular Weight | 321.87 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[cyclopropyl(thiophen-3-ylmethyl)amino]propan-1-ol |
| SMILES | OC(CCN(Cc1ccsc1)C1CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H20ClNOS/c18-15-3-1-14(2-4-15)17(20)7-9-19(16-5-6-16)11-13-8-10-21-12-13/h1-4,8,10,12,16-17,20H,5-7,9,11H2 |
| InChIKey | HNLJNZNARVHMRB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.87 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |