C13H21N3OS — CID 54965704
5-[cyclopropyl(thiophen-3-ylmethyl)amino]-N'-hydroxypentanimidamide (PubChem CID 54965704) has the molecular formula C13H21N3OS and a molecular weight of 267.40 g/mol. Its IUPAC name is 5-[cyclopropyl(thiophen-3-ylmethyl)amino]-N'-hydroxypentanimidamide.
| Compound Name | 5-[cyclopropyl(thiophen-3-ylmethyl)amino]-N'-hydroxypentanimidamide |
|---|---|
| PubChem CID | 54965704 |
| Molecular Formula | C13H21N3OS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 5-[cyclopropyl(thiophen-3-ylmethyl)amino]-N'-hydroxypentanimidamide |
| SMILES | NC(CCCCN(Cc1ccsc1)C1CC1)=NO |
| InChI | InChI=1S/C13H21N3OS/c14-13(15-17)3-1-2-7-16(12-4-5-12)9-11-6-8-18-10-11/h6,8,10,12,17H,1-5,7,9H2,(H2,14,15) |
| InChIKey | PJSDBDPYPOZXNP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|