C9H15NO2S — CID 61474151
(2S)-3-(2-thiophen-3-ylethylamino)propane-1,2-diol (PubChem CID 61474151) has the molecular formula C9H15NO2S and a molecular weight of 201.29 g/mol. Its IUPAC name is (2S)-3-(2-thiophen-3-ylethylamino)propane-1,2-diol.
| Compound Name | (2S)-3-(2-thiophen-3-ylethylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 61474151 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | (2S)-3-(2-thiophen-3-ylethylamino)propane-1,2-diol |
| SMILES | OC[C@@H](O)CNCCc1ccsc1 |
| InChI | InChI=1S/C9H15NO2S/c11-6-9(12)5-10-3-1-8-2-4-13-7-8/h2,4,7,9-12H,1,3,5-6H2/t9-/m0/s1 |
| InChIKey | MLTBSAGBWTUXPY-VIFPVBQESA-N |
| XLogP | 0.23 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|