C17H23NO2S — CID 61473977
1-(2,4-dimethylphenoxy)-3-(2-thiophen-3-ylethylamino)propan-2-ol (PubChem CID 61473977) has the molecular formula C17H23NO2S and a molecular weight of 305.44 g/mol. Its IUPAC name is 1-(2,4-dimethylphenoxy)-3-(2-thiophen-3-ylethylamino)propan-2-ol.
| Compound Name | 1-(2,4-dimethylphenoxy)-3-(2-thiophen-3-ylethylamino)propan-2-ol |
|---|---|
| PubChem CID | 61473977 |
| Molecular Formula | C17H23NO2S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 1-(2,4-dimethylphenoxy)-3-(2-thiophen-3-ylethylamino)propan-2-ol |
| SMILES | Cc1ccc(OCC(O)CNCCc2ccsc2)c(C)c1 |
| InChI | InChI=1S/C17H23NO2S/c1-13-3-4-17(14(2)9-13)20-11-16(19)10-18-7-5-15-6-8-21-12-15/h3-4,6,8-9,12,16,18-19H,5,7,10-11H2,1-2H3 |
| InChIKey | DTNQTMUVZAMTKK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|