C23H33NO4 — CID 2293480
(2R)-1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-(5-methyl-2-propan-2-ylphenoxy)propan-2-ol (PubChem CID 2293480) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is (2R)-1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-(5-methyl-2-propan-2-ylphenoxy)propan-2-ol.
| Compound Name | (2R)-1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-(5-methyl-2-propan-2-ylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 2293480 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | (2R)-1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-(5-methyl-2-propan-2-ylphenoxy)propan-2-ol |
| SMILES | COc1ccc(CCNC[C@@H](O)COc2cc(C)ccc2C(C)C)cc1OC |
| InChI | InChI=1S/C23H33NO4/c1-16(2)20-8-6-17(3)12-22(20)28-15-19(25)14-24-11-10-18-7-9-21(26-4)23(13-18)27-5/h6-9,12-13,16,19,24-25H,10-11,14-15H2,1-5H3/t19-/m1/s1 |
| InChIKey | XRKHYVZOIUTCBD-LJQANCHMSA-N |
| XLogP | 3.71 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|