C23H33NO6 — CID 23471094
1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[2-(2-methoxyethoxymethyl)phenoxy]propan-2-ol (PubChem CID 23471094) has the molecular formula C23H33NO6 and a molecular weight of 419.52 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[2-(2-methoxyethoxymethyl)phenoxy]propan-2-ol.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[2-(2-methoxyethoxymethyl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 23471094 |
| Molecular Formula | C23H33NO6 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[2-(2-methoxyethoxymethyl)phenoxy]propan-2-ol |
| SMILES | COCCOCc1ccccc1OCC(O)CNCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H33NO6/c1-26-12-13-29-16-19-6-4-5-7-21(19)30-17-20(25)15-24-11-10-18-8-9-22(27-2)23(14-18)28-3/h4-9,14,20,24-25H,10-13,15-17H2,1-3H3 |
| InChIKey | MRLAZJQYTZFOOU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|