C25H35NO6 — CID 23471099
1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[2-(2-prop-2-enoxyethoxymethyl)phenoxy]propan-2-ol (PubChem CID 23471099) has the molecular formula C25H35NO6 and a molecular weight of 445.56 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[2-(2-prop-2-enoxyethoxymethyl)phenoxy]propan-2-ol.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[2-(2-prop-2-enoxyethoxymethyl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 23471099 |
| Molecular Formula | C25H35NO6 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-[2-(2-prop-2-enoxyethoxymethyl)phenoxy]propan-2-ol |
| SMILES | C=CCOCCOCc1ccccc1OCC(O)CNCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C25H35NO6/c1-4-13-30-14-15-31-18-21-7-5-6-8-23(21)32-19-22(27)17-26-12-11-20-9-10-24(28-2)25(16-20)29-3/h4-10,16,22,26-27H,1,11-15,17-19H2,2-3H3 |
| InChIKey | QPZUYILMRPTSKZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|