C23H33NO5 — CID 13374992
3-(3,4-dimethoxyphenyl)-1-[2-[2-hydroxy-3-(propylamino)propoxy]phenyl]propan-1-ol (PubChem CID 13374992) has the molecular formula C23H33NO5 and a molecular weight of 403.52 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-1-[2-[2-hydroxy-3-(propylamino)propoxy]phenyl]propan-1-ol.
| Compound Name | 3-(3,4-dimethoxyphenyl)-1-[2-[2-hydroxy-3-(propylamino)propoxy]phenyl]propan-1-ol |
|---|---|
| PubChem CID | 13374992 |
| Molecular Formula | C23H33NO5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-1-[2-[2-hydroxy-3-(propylamino)propoxy]phenyl]propan-1-ol |
| SMILES | CCCNCC(O)COc1ccccc1C(O)CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H33NO5/c1-4-13-24-15-18(25)16-29-21-8-6-5-7-19(21)20(26)11-9-17-10-12-22(27-2)23(14-17)28-3/h5-8,10,12,14,18,20,24-26H,4,9,11,13,15-16H2,1-3H3 |
| InChIKey | NQQBEIKBQVLPMF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|