C21H29NO4 — CID 8017015
(2S)-1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-(2,6-dimethylphenoxy)propan-2-ol (PubChem CID 8017015) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is (2S)-1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-(2,6-dimethylphenoxy)propan-2-ol.
| Compound Name | (2S)-1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-(2,6-dimethylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 8017015 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | (2S)-1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-(2,6-dimethylphenoxy)propan-2-ol |
| SMILES | COc1ccc(CCNC[C@H](O)COc2c(C)cccc2C)cc1OC |
| InChI | InChI=1S/C21H29NO4/c1-15-6-5-7-16(2)21(15)26-14-18(23)13-22-11-10-17-8-9-19(24-3)20(12-17)25-4/h5-9,12,18,22-23H,10-11,13-14H2,1-4H3/t18-/m0/s1 |
| InChIKey | OXGMHVQJBSWRNK-SFHVURJKSA-N |
| XLogP | 2.89 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|