C25H32ClNO6 — CID 75366065
7-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-hydroxypropoxy]-3,4,8-trimethylchromen-2-one;hydrochloride (PubChem CID 75366065) has the molecular formula C25H32ClNO6 and a molecular weight of 477.99 g/mol. Its IUPAC name is 7-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-hydroxypropoxy]-3,4,8-trimethylchromen-2-one;hydrochloride.
| Compound Name | 7-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-hydroxypropoxy]-3,4,8-trimethylchromen-2-one;hydrochloride |
|---|---|
| PubChem CID | 75366065 |
| Molecular Formula | C25H32ClNO6 |
| Molecular Weight | 477.99 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 7-[3-[2-(3,4-dimethoxyphenyl)ethylamino]-2-hydroxypropoxy]-3,4,8-trimethylchromen-2-one;hydrochloride |
| SMILES | COc1ccc(CCNCC(O)COc2ccc3c(C)c(C)c(=O)oc3c2C)cc1OC.Cl |
| InChI | InChI=1S/C25H31NO6.ClH/c1-15-16(2)25(28)32-24-17(3)21(9-7-20(15)24)31-14-19(27)13-26-11-10-18-6-8-22(29-4)23(12-18)30-5;/h6-9,12,19,26-27H,10-11,13-14H2,1-5H3;1H |
| InChIKey | RSFVZIHODRIFLC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 90.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.99 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|